C23H32N2O3S — CID 121179330
1-(4-butoxyphenyl)-3-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]urea (PubChem CID 121179330) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]urea.
| Compound Name | 1-(4-butoxyphenyl)-3-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]urea |
|---|---|
| PubChem CID | 121179330 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]urea |
| SMILES | CCCCOc1ccc(NC(=O)NCC2(c3ccc(C(C)O)s3)CCCC2)cc1 |
| InChI | InChI=1S/C23H32N2O3S/c1-3-4-15-28-19-9-7-18(8-10-19)25-22(27)24-16-23(13-5-6-14-23)21-12-11-20(29-21)17(2)26/h7-12,17,26H,3-6,13-16H2,1-2H3,(H2,24,25,27) |
| InChIKey | XWBQJSVIGNLZFP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|