C19H16N2O2S — CID 121179381
N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-1H-indole-2-carboxamide (PubChem CID 121179381) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 121179381 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCC(O)c1csc2ccccc12)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H16N2O2S/c22-17(14-11-24-18-8-4-2-6-13(14)18)10-20-19(23)16-9-12-5-1-3-7-15(12)21-16/h1-9,11,17,21-22H,10H2,(H,20,23) |
| InChIKey | VBMBYLOFTCKVIH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |