C13H11N5O2S — CID 121181630
(Z)-N-[(8-oxo-7H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 121181630) has the molecular formula C13H11N5O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is (Z)-N-[(8-oxo-7H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (Z)-N-[(8-oxo-7H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 121181630 |
| Molecular Formula | C13H11N5O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (Z)-N-[(8-oxo-7H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C\c1cccs1)NCc1nnc2c(=O)[nH]ccn12 |
| InChI | InChI=1S/C13H11N5O2S/c19-11(4-3-9-2-1-7-21-9)15-8-10-16-17-12-13(20)14-5-6-18(10)12/h1-7H,8H2,(H,14,20)(H,15,19)/b4-3- |
| InChIKey | ILILFJHLNVDZGQ-ARJAWSKDSA-N |
| XLogP | 0.81 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|