C10H13F2N3O — CID 121184623
3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one (PubChem CID 121184623) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is 3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one.
| Compound Name | 3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 121184623 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(N2CCC(F)(F)CC2)c1=O |
| InChI | InChI=1S/C10H13F2N3O/c1-14-7-4-13-8(9(14)16)15-5-2-10(11,12)3-6-15/h4,7H,2-3,5-6H2,1H3 |
| InChIKey | KRPRPWSOBHMAEY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |