C9H17F2NO2S — CID 121184679
4,4-difluoro-1-(2-methylpropylsulfonyl)piperidine (PubChem CID 121184679) has the molecular formula C9H17F2NO2S and a molecular weight of 241.30 g/mol. Its IUPAC name is 4,4-difluoro-1-(2-methylpropylsulfonyl)piperidine.
| Compound Name | 4,4-difluoro-1-(2-methylpropylsulfonyl)piperidine |
|---|---|
| PubChem CID | 121184679 |
| Molecular Formula | C9H17F2NO2S |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4,4-difluoro-1-(2-methylpropylsulfonyl)piperidine |
| SMILES | CC(C)CS(=O)(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H17F2NO2S/c1-8(2)7-15(13,14)12-5-3-9(10,11)4-6-12/h8H,3-7H2,1-2H3 |
| InChIKey | WGTWOJKOHXVLRQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |