C7H13F2NO2S — CID 58122750
1-(1,1-difluoroethylsulfonyl)piperidine (PubChem CID 58122750) has the molecular formula C7H13F2NO2S and a molecular weight of 213.25 g/mol. Its IUPAC name is 1-(1,1-difluoroethylsulfonyl)piperidine.
| Compound Name | 1-(1,1-difluoroethylsulfonyl)piperidine |
|---|---|
| PubChem CID | 58122750 |
| Molecular Formula | C7H13F2NO2S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1-(1,1-difluoroethylsulfonyl)piperidine |
| SMILES | CC(F)(F)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C7H13F2NO2S/c1-7(8,9)13(11,12)10-5-3-2-4-6-10/h2-6H2,1H3 |
| InChIKey | BLWMUPBXPLZFPH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |