C11H18N4S — CID 121184724
2-(4-cyclopentylpiperazin-1-yl)-1,3,4-thiadiazole (PubChem CID 121184724) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is 2-(4-cyclopentylpiperazin-1-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(4-cyclopentylpiperazin-1-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 121184724 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-(4-cyclopentylpiperazin-1-yl)-1,3,4-thiadiazole |
| SMILES | c1nnc(N2CCN(C3CCCC3)CC2)s1 |
| InChI | InChI=1S/C11H18N4S/c1-2-4-10(3-1)14-5-7-15(8-6-14)11-13-12-9-16-11/h9-10H,1-8H2 |
| InChIKey | ZEGLHEZNTKYWAE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |