C10H17N3S — CID 169304025
2-(4-propan-2-ylpiperidin-1-yl)-1,3,4-thiadiazole (PubChem CID 169304025) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-(4-propan-2-ylpiperidin-1-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(4-propan-2-ylpiperidin-1-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 169304025 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-(4-propan-2-ylpiperidin-1-yl)-1,3,4-thiadiazole |
| SMILES | CC(C)C1CCN(c2nncs2)CC1 |
| InChI | InChI=1S/C10H17N3S/c1-8(2)9-3-5-13(6-4-9)10-12-11-7-14-10/h7-9H,3-6H2,1-2H3 |
| InChIKey | AKTPZDLPLFRBBD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |