C12H16FN3 — CID 121185348
5-(5-fluoro-2-pyridinyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 121185348) has the molecular formula C12H16FN3 and a molecular weight of 221.28 g/mol. Its IUPAC name is 5-(5-fluoro-2-pyridinyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(5-fluoro-2-pyridinyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 121185348 |
| Molecular Formula | C12H16FN3 |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 5-(5-fluoro-2-pyridinyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CN1CC2CN(c3ccc(F)cn3)CC2C1 |
| InChI | InChI=1S/C12H16FN3/c1-15-5-9-7-16(8-10(9)6-15)12-3-2-11(13)4-14-12/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | OILIXXCBKFMUNB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |