C11H17N5O3S — CID 121187533
N-methyl-N-[2-oxo-2-[3-(pyrimidin-2-ylamino)azetidin-1-yl]ethyl]methanesulfonamide (PubChem CID 121187533) has the molecular formula C11H17N5O3S and a molecular weight of 299.36 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-[3-(pyrimidin-2-ylamino)azetidin-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-methyl-N-[2-oxo-2-[3-(pyrimidin-2-ylamino)azetidin-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 121187533 |
| Molecular Formula | C11H17N5O3S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-methyl-N-[2-oxo-2-[3-(pyrimidin-2-ylamino)azetidin-1-yl]ethyl]methanesulfonamide |
| SMILES | CN(CC(=O)N1CC(Nc2ncccn2)C1)S(C)(=O)=O |
| InChI | InChI=1S/C11H17N5O3S/c1-15(20(2,18)19)8-10(17)16-6-9(7-16)14-11-12-4-3-5-13-11/h3-5,9H,6-8H2,1-2H3,(H,12,13,14) |
| InChIKey | WRLCWXYTIHMMPP-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |