C14H13ClN4O — CID 121020964
(2-chlorophenyl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone (PubChem CID 121020964) has the molecular formula C14H13ClN4O and a molecular weight of 288.74 g/mol. Its IUPAC name is (2-chlorophenyl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone.
| Compound Name | (2-chlorophenyl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 121020964 |
| Molecular Formula | C14H13ClN4O |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (2-chlorophenyl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)N1CC(Nc2ncccn2)C1 |
| InChI | InChI=1S/C14H13ClN4O/c15-12-5-2-1-4-11(12)13(20)19-8-10(9-19)18-14-16-6-3-7-17-14/h1-7,10H,8-9H2,(H,16,17,18) |
| InChIKey | OETKGCNSOSYCPG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |