C15H13ClF2N4O — CID 166278451
(4-chloro-2,3-difluorophenyl)-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]methanone (PubChem CID 166278451) has the molecular formula C15H13ClF2N4O and a molecular weight of 338.75 g/mol. Its IUPAC name is (4-chloro-2,3-difluorophenyl)-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]methanone.
| Compound Name | (4-chloro-2,3-difluorophenyl)-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 166278451 |
| Molecular Formula | C15H13ClF2N4O |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (4-chloro-2,3-difluorophenyl)-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(F)c1F)N1CCC(Nc2ncccn2)C1 |
| InChI | InChI=1S/C15H13ClF2N4O/c16-11-3-2-10(12(17)13(11)18)14(23)22-7-4-9(8-22)21-15-19-5-1-6-20-15/h1-3,5-6,9H,4,7-8H2,(H,19,20,21) |
| InChIKey | HXAJMHYWLUUWBC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|