C17H18F2N4O2 — CID 18469248
methyl 2,3-difluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoate (PubChem CID 18469248) has the molecular formula C17H18F2N4O2 and a molecular weight of 348.35 g/mol. Its IUPAC name is methyl 2,3-difluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoate.
| Compound Name | methyl 2,3-difluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 18469248 |
| Molecular Formula | C17H18F2N4O2 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | methyl 2,3-difluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCC(Nc3ncccn3)CC2)c(F)c1F |
| InChI | InChI=1S/C17H18F2N4O2/c1-25-16(24)12-3-4-13(15(19)14(12)18)23-9-5-11(6-10-23)22-17-20-7-2-8-21-17/h2-4,7-8,11H,5-6,9-10H2,1H3,(H,20,21,22) |
| InChIKey | SEUIOXAGQOUHFX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |