C26H26F2N6O7S — CID 87099860
4-[(2S)-2-amino-3-[[2,3-difluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoyl]oxysulfonylbenzoic acid (PubChem CID 87099860) has the molecular formula C26H26F2N6O7S and a molecular weight of 604.59 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-[[2,3-difluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoyl]oxysulfonylbenzoic acid.
| Compound Name | 4-[(2S)-2-amino-3-[[2,3-difluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoyl]oxysulfonylbenzoic acid |
|---|---|
| PubChem CID | 87099860 |
| Molecular Formula | C26H26F2N6O7S |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 4-[(2S)-2-amino-3-[[2,3-difluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoyl]oxysulfonylbenzoic acid |
| SMILES | N[C@@H](CNC(=O)c1ccc(N2CCC(Nc3ncccn3)CC2)c(F)c1F)C(=O)OS(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H26F2N6O7S/c27-21-18(6-7-20(22(21)28)34-12-8-16(9-13-34)33-26-30-10-1-11-31-26)23(35)32-14-19(29)25(38)41-42(39,40)17-4-2-15(3-5-17)24(36)37/h1-7,10-11,16,19H,8-9,12-14,29H2,(H,32,35)(H,36,37)(H,30,31,33)/t19-/m0/s1 |
| InChIKey | AITHMBZWZFXPNL-IBGZPJMESA-N |
| XLogP | 1.52 |
| TPSA | 193.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|