C19H23FN6O3 — CID 18469279
amino 3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoate (PubChem CID 18469279) has the molecular formula C19H23FN6O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is amino 3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoate.
| Compound Name | amino 3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 18469279 |
| Molecular Formula | C19H23FN6O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | amino 3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoate |
| SMILES | NOC(=O)CCNC(=O)c1ccc(N2CCC(Nc3ncccn3)CC2)c(F)c1 |
| InChI | InChI=1S/C19H23FN6O3/c20-15-12-13(18(28)22-9-4-17(27)29-21)2-3-16(15)26-10-5-14(6-11-26)25-19-23-7-1-8-24-19/h1-3,7-8,12,14H,4-6,9-11,21H2,(H,22,28)(H,23,24,25) |
| InChIKey | CGEUHRYQRWWSCL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|