C19H23FN6O3 — CID 66672209
3-amino-3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid (PubChem CID 66672209) has the molecular formula C19H23FN6O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is 3-amino-3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-amino-3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66672209 |
| Molecular Formula | C19H23FN6O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-amino-3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid |
| SMILES | NC(CC(=O)O)NC(=O)c1ccc(N2CCC(Nc3ncccn3)CC2)c(F)c1 |
| InChI | InChI=1S/C19H23FN6O3/c20-14-10-12(18(29)25-16(21)11-17(27)28)2-3-15(14)26-8-4-13(5-9-26)24-19-22-6-1-7-23-19/h1-3,6-7,10,13,16H,4-5,8-9,11,21H2,(H,25,29)(H,27,28)(H,22,23,24) |
| InChIKey | MDWKZAJKLCMQOU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|