C28H33FN6O6S — CID 174428752
(2S)-3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]-2-(prop-2-enylsulfonylamino)propanoic acid;phenol (PubChem CID 174428752) has the molecular formula C28H33FN6O6S and a molecular weight of 600.67 g/mol. Its IUPAC name is (2S)-3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]-2-(prop-2-enylsulfonylamino)propanoic acid;phenol.
| Compound Name | (2S)-3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]-2-(prop-2-enylsulfonylamino)propanoic acid;phenol |
|---|---|
| PubChem CID | 174428752 |
| Molecular Formula | C28H33FN6O6S |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | (2S)-3-[[3-fluoro-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]-2-(prop-2-enylsulfonylamino)propanoic acid;phenol |
| SMILES | C=CCS(=O)(=O)N[C@@H](CNC(=O)c1ccc(N2CCC(Nc3ncccn3)CC2)c(F)c1)C(=O)O.Oc1ccccc1 |
| InChI | InChI=1S/C22H27FN6O5S.C6H6O/c1-2-12-35(33,34)28-18(21(31)32)14-26-20(30)15-4-5-19(17(23)13-15)29-10-6-16(7-11-29)27-22-24-8-3-9-25-22;7-6-4-2-1-3-5-6/h2-5,8-9,13,16,18,28H,1,6-7,10-12,14H2,(H,26,30)(H,31,32)(H,24,25,27);1-5,7H/t18-;/m0./s1 |
| InChIKey | NNTJYWZCJCLHFY-FERBBOLQSA-N |
| XLogP | 2.38 |
| TPSA | 173.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|