C27H32N6O7S — CID 87099974
3-[(4-methoxyphenyl)sulfonylamino]-3-[[3-methoxy-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid (PubChem CID 87099974) has the molecular formula C27H32N6O7S and a molecular weight of 584.66 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)sulfonylamino]-3-[[3-methoxy-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[(4-methoxyphenyl)sulfonylamino]-3-[[3-methoxy-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 87099974 |
| Molecular Formula | C27H32N6O7S |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | 3-[(4-methoxyphenyl)sulfonylamino]-3-[[3-methoxy-4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid |
| SMILES | COc1ccc(S(=O)(=O)NC(CC(=O)O)NC(=O)c2ccc(N3CCC(Nc4ncccn4)CC3)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H32N6O7S/c1-39-20-5-7-21(8-6-20)41(37,38)32-24(17-25(34)35)31-26(36)18-4-9-22(23(16-18)40-2)33-14-10-19(11-15-33)30-27-28-12-3-13-29-27/h3-9,12-13,16,19,24,32H,10-11,14-15,17H2,1-2H3,(H,31,36)(H,34,35)(H,28,29,30) |
| InChIKey | HOVOZJMLJNFNBO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|