C30H38N6O6S — CID 87999953
3-[(4-methoxyphenyl)sulfonylamino]-4,4-dimethyl-3-[[3-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]pentanoic acid (PubChem CID 87999953) has the molecular formula C30H38N6O6S and a molecular weight of 610.74 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)sulfonylamino]-4,4-dimethyl-3-[[3-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]pentanoic acid.
| Compound Name | 3-[(4-methoxyphenyl)sulfonylamino]-4,4-dimethyl-3-[[3-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 87999953 |
| Molecular Formula | C30H38N6O6S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 3-[(4-methoxyphenyl)sulfonylamino]-4,4-dimethyl-3-[[3-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]pentanoic acid |
| SMILES | COc1ccc(S(=O)(=O)NC(CC(=O)O)(NC(=O)c2cccc(N3CCC(Nc4ncccn4)CC3)c2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H38N6O6S/c1-29(2,3)30(20-26(37)38,35-43(40,41)25-11-9-24(42-4)10-12-25)34-27(39)21-7-5-8-23(19-21)36-17-13-22(14-18-36)33-28-31-15-6-16-32-28/h5-12,15-16,19,22,35H,13-14,17-18,20H2,1-4H3,(H,34,39)(H,37,38)(H,31,32,33) |
| InChIKey | XXJWUOCWVPNDGQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 162.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|