C25H30N6O4S — CID 66671899
(2S)-2-(benzenesulfonamido)-3-[[4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]phenyl]methylamino]propanoic acid (PubChem CID 66671899) has the molecular formula C25H30N6O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-3-[[4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]phenyl]methylamino]propanoic acid.
| Compound Name | (2S)-2-(benzenesulfonamido)-3-[[4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 66671899 |
| Molecular Formula | C25H30N6O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-3-[[4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]phenyl]methylamino]propanoic acid |
| SMILES | O=C(O)[C@H](CNCc1ccc(N2CCC(Nc3ncccn3)CC2)cc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H30N6O4S/c32-24(33)23(30-36(34,35)22-5-2-1-3-6-22)18-26-17-19-7-9-21(10-8-19)31-15-11-20(12-16-31)29-25-27-13-4-14-28-25/h1-10,13-14,20,23,26,30H,11-12,15-18H2,(H,32,33)(H,27,28,29)/t23-/m0/s1 |
| InChIKey | DOGPJHKEHCIIGQ-QHCPKHFHSA-N |
| XLogP | 2.08 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|