C26H30N6O5S — CID 174367600
benzenesulfonyl 2-amino-2-methyl-3-[[4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoate (PubChem CID 174367600) has the molecular formula C26H30N6O5S and a molecular weight of 538.63 g/mol. Its IUPAC name is benzenesulfonyl 2-amino-2-methyl-3-[[4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoate.
| Compound Name | benzenesulfonyl 2-amino-2-methyl-3-[[4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 174367600 |
| Molecular Formula | C26H30N6O5S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | benzenesulfonyl 2-amino-2-methyl-3-[[4-[4-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoate |
| SMILES | CC(N)(CNC(=O)c1ccc(N2CCC(Nc3ncccn3)CC2)cc1)C(=O)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H30N6O5S/c1-26(27,24(34)37-38(35,36)22-6-3-2-4-7-22)18-30-23(33)19-8-10-21(11-9-19)32-16-12-20(13-17-32)31-25-28-14-5-15-29-25/h2-11,14-15,20H,12-13,16-18,27H2,1H3,(H,30,33)(H,28,29,31) |
| InChIKey | XYBFUPFQHNKXAP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|