C19H23N5O4 — CID 70099091
(2S)-2-hydroxy-3-[[4-[2-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid (PubChem CID 70099091) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[[4-[2-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[[4-[2-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70099091 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (2S)-2-hydroxy-3-[[4-[2-(pyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid |
| SMILES | O=C(NC[C@H](O)C(=O)O)c1ccc(N2CCCCC2Nc2ncccn2)cc1 |
| InChI | InChI=1S/C19H23N5O4/c25-15(18(27)28)12-22-17(26)13-5-7-14(8-6-13)24-11-2-1-4-16(24)23-19-20-9-3-10-21-19/h3,5-10,15-16,25H,1-2,4,11-12H2,(H,22,26)(H,27,28)(H,20,21,23)/t15-,16?/m0/s1 |
| InChIKey | KMCYJYVDPSYKPF-VYRBHSGPSA-N |
| XLogP | 1.08 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |