C14H15ClN4O2S — CID 121187637
N-[1-(3-chloro-4-methylphenyl)sulfonylazetidin-3-yl]pyrimidin-2-amine (PubChem CID 121187637) has the molecular formula C14H15ClN4O2S and a molecular weight of 338.82 g/mol. Its IUPAC name is N-[1-(3-chloro-4-methylphenyl)sulfonylazetidin-3-yl]pyrimidin-2-amine.
| Compound Name | N-[1-(3-chloro-4-methylphenyl)sulfonylazetidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 121187637 |
| Molecular Formula | C14H15ClN4O2S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[1-(3-chloro-4-methylphenyl)sulfonylazetidin-3-yl]pyrimidin-2-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(Nc3ncccn3)C2)cc1Cl |
| InChI | InChI=1S/C14H15ClN4O2S/c1-10-3-4-12(7-13(10)15)22(20,21)19-8-11(9-19)18-14-16-5-2-6-17-14/h2-7,11H,8-9H2,1H3,(H,16,17,18) |
| InChIKey | OTLFPGPEXYTUQQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |