C21H21FN4O2S — CID 121190809
4-cyclopropyl-1-[1-[4-(4-fluorophenyl)phenyl]sulfonylpyrrolidin-3-yl]triazole (PubChem CID 121190809) has the molecular formula C21H21FN4O2S and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-cyclopropyl-1-[1-[4-(4-fluorophenyl)phenyl]sulfonylpyrrolidin-3-yl]triazole.
| Compound Name | 4-cyclopropyl-1-[1-[4-(4-fluorophenyl)phenyl]sulfonylpyrrolidin-3-yl]triazole |
|---|---|
| PubChem CID | 121190809 |
| Molecular Formula | C21H21FN4O2S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-cyclopropyl-1-[1-[4-(4-fluorophenyl)phenyl]sulfonylpyrrolidin-3-yl]triazole |
| SMILES | O=S(=O)(c1ccc(-c2ccc(F)cc2)cc1)N1CCC(n2cc(C3CC3)nn2)C1 |
| InChI | InChI=1S/C21H21FN4O2S/c22-18-7-3-15(4-8-18)16-5-9-20(10-6-16)29(27,28)25-12-11-19(13-25)26-14-21(23-24-26)17-1-2-17/h3-10,14,17,19H,1-2,11-13H2 |
| InChIKey | YACRKTPTTZCZKE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |