C18H25NO3S — CID 121191833
2-cyclopentyl-1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)ethanone (PubChem CID 121191833) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-cyclopentyl-1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)ethanone.
| Compound Name | 2-cyclopentyl-1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 121191833 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-cyclopentyl-1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)ethanone |
| SMILES | O=C(CC1CCCC1)N1CCC(c2ccccc2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C18H25NO3S/c20-18(14-15-6-4-5-7-15)19-11-10-17(23(21,22)13-12-19)16-8-2-1-3-9-16/h1-3,8-9,15,17H,4-7,10-14H2 |
| InChIKey | JVQOHJGOTXIRCK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |