C25H25NO4S — CID 121192005
1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)-2-(4-phenylphenoxy)ethanone (PubChem CID 121192005) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)-2-(4-phenylphenoxy)ethanone.
| Compound Name | 1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)-2-(4-phenylphenoxy)ethanone |
|---|---|
| PubChem CID | 121192005 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)-2-(4-phenylphenoxy)ethanone |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)N1CCC(c2ccccc2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C25H25NO4S/c27-25(19-30-23-13-11-21(12-14-23)20-7-3-1-4-8-20)26-16-15-24(31(28,29)18-17-26)22-9-5-2-6-10-22/h1-14,24H,15-19H2 |
| InChIKey | RYIBHEGHSPYJFN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |