C21H19NO5S — CID 121191939
2-(1,1-dioxo-7-phenyl-1,4-thiazepane-4-carbonyl)chromen-4-one (PubChem CID 121191939) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-(1,1-dioxo-7-phenyl-1,4-thiazepane-4-carbonyl)chromen-4-one.
| Compound Name | 2-(1,1-dioxo-7-phenyl-1,4-thiazepane-4-carbonyl)chromen-4-one |
|---|---|
| PubChem CID | 121191939 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-(1,1-dioxo-7-phenyl-1,4-thiazepane-4-carbonyl)chromen-4-one |
| SMILES | O=C(c1cc(=O)c2ccccc2o1)N1CCC(c2ccccc2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C21H19NO5S/c23-17-14-19(27-18-9-5-4-8-16(17)18)21(24)22-11-10-20(28(25,26)13-12-22)15-6-2-1-3-7-15/h1-9,14,20H,10-13H2 |
| InChIKey | COALOGGBSSQIIH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |