C14H20ClNO4S2 — CID 121193134
7-(2-chlorophenyl)-4-propan-2-ylsulfonyl-1,4-thiazepane 1,1-dioxide (PubChem CID 121193134) has the molecular formula C14H20ClNO4S2 and a molecular weight of 365.90 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-4-propan-2-ylsulfonyl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 7-(2-chlorophenyl)-4-propan-2-ylsulfonyl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 121193134 |
| Molecular Formula | C14H20ClNO4S2 |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 7-(2-chlorophenyl)-4-propan-2-ylsulfonyl-1,4-thiazepane 1,1-dioxide |
| SMILES | CC(C)S(=O)(=O)N1CCC(c2ccccc2Cl)S(=O)(=O)CC1 |
| InChI | InChI=1S/C14H20ClNO4S2/c1-11(2)22(19,20)16-8-7-14(21(17,18)10-9-16)12-5-3-4-6-13(12)15/h3-6,11,14H,7-10H2,1-2H3 |
| InChIKey | WDMNASAPGISJMM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |