C17H24ClNO4S2 — CID 121193152
7-(2-chlorophenyl)-4-cyclohexylsulfonyl-1,4-thiazepane 1,1-dioxide (PubChem CID 121193152) has the molecular formula C17H24ClNO4S2 and a molecular weight of 405.97 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-4-cyclohexylsulfonyl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 7-(2-chlorophenyl)-4-cyclohexylsulfonyl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 121193152 |
| Molecular Formula | C17H24ClNO4S2 |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 7-(2-chlorophenyl)-4-cyclohexylsulfonyl-1,4-thiazepane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(S(=O)(=O)C2CCCCC2)CCC1c1ccccc1Cl |
| InChI | InChI=1S/C17H24ClNO4S2/c18-16-9-5-4-8-15(16)17-10-11-19(12-13-24(17,20)21)25(22,23)14-6-2-1-3-7-14/h4-5,8-9,14,17H,1-3,6-7,10-13H2 |
| InChIKey | NUHQZYVTALABOC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |