C16H21F2NO2 — CID 121194081
N-(4,4-difluorocyclohexyl)-2-(4-methoxy-3-methylphenyl)acetamide (PubChem CID 121194081) has the molecular formula C16H21F2NO2 and a molecular weight of 297.34 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-(4-methoxy-3-methylphenyl)acetamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-(4-methoxy-3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 121194081 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-(4-methoxy-3-methylphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NC2CCC(F)(F)CC2)cc1C |
| InChI | InChI=1S/C16H21F2NO2/c1-11-9-12(3-4-14(11)21-2)10-15(20)19-13-5-7-16(17,18)8-6-13/h3-4,9,13H,5-8,10H2,1-2H3,(H,19,20) |
| InChIKey | LHFZSPULANNJCU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |