C13H14ClO3P — CID 12119561
7-Chloro-3-cyclopropyl-1-ethoxy-2,1lambda5-benzoxaphosphinine 1-oxide (PubChem CID 12119561) has the molecular formula C13H14ClO3P and a molecular weight of 284.67 g/mol. Its IUPAC name is 7-chloro-3-cyclopropyl-1-ethoxy-2,1lambda5-benzoxaphosphinine 1-oxide.
| Compound Name | 7-Chloro-3-cyclopropyl-1-ethoxy-2,1lambda5-benzoxaphosphinine 1-oxide |
|---|---|
| PubChem CID | 12119561 |
| Molecular Formula | C13H14ClO3P |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 7-chloro-3-cyclopropyl-1-ethoxy-2,1lambda5-benzoxaphosphinine 1-oxide |
| SMILES | CCOP1(=O)C2=C(C=CC(=C2)Cl)C=C(O1)C3CC3 |
| InChI | InChI=1S/C13H14ClO3P/c1-2-16-18(15)13-8-11(14)6-5-10(13)7-12(17-18)9-3-4-9/h5-9H,2-4H2,1H3 |
| InChIKey | DRHOGKRCGPHIJD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | 405 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|