C15H12F3N5O3S — CID 121196161
N-[(1-pyridin-4-yltriazol-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 121196161) has the molecular formula C15H12F3N5O3S and a molecular weight of 399.35 g/mol. Its IUPAC name is N-[(1-pyridin-4-yltriazol-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(1-pyridin-4-yltriazol-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 121196161 |
| Molecular Formula | C15H12F3N5O3S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N-[(1-pyridin-4-yltriazol-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cn(-c2ccncc2)nn1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F3N5O3S/c16-15(17,18)26-13-1-3-14(4-2-13)27(24,25)20-9-11-10-23(22-21-11)12-5-7-19-8-6-12/h1-8,10,20H,9H2 |
| InChIKey | HWEZAWOXDWNMSA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |