C18H25NO2S — CID 121197456
1-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-3-(4-methylsulfanylphenyl)propan-1-one (PubChem CID 121197456) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-3-(4-methylsulfanylphenyl)propan-1-one.
| Compound Name | 1-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-3-(4-methylsulfanylphenyl)propan-1-one |
|---|---|
| PubChem CID | 121197456 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-3-(4-methylsulfanylphenyl)propan-1-one |
| SMILES | CSc1ccc(CCC(=O)N2CCC(OCC3CC3)C2)cc1 |
| InChI | InChI=1S/C18H25NO2S/c1-22-17-7-4-14(5-8-17)6-9-18(20)19-11-10-16(12-19)21-13-15-2-3-15/h4-5,7-8,15-16H,2-3,6,9-13H2,1H3 |
| InChIKey | YRCKWHYPVNUWLP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |