About 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid
2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid (PubChem CID 121202742) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid.
Analyze 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid?
The IUPAC name of 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid (CID 121202742) is 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid.
What is the SMILES notation for 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid?
The canonical SMILES for 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid is COCC1CN(C(C)C(=O)O)CC1(C)C.
What is the InChIKey of 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid?
The InChIKey is KZWWEDRIGQYUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-8(10(13)14)12-5-9(6-15-4)11(2,3)7-12/h8-9H,5-7H2,1-4H3,(H,13,14).
What are the key properties of 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid?
2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid has a molecular weight of 215.29 g/mol, XLogP of 1.06, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(methoxymethyl)-3,3-dimethylpyrrolidin-1-yl]propanoic acid is sourced from PubChem (CID 121202742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).