2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid

C11H21NO4 — CID 121203953

IUPAC2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid
SMILESCCOC1CN(C(C)C(=O)O)CC1OCC
InChIInChI=1S/C11H21NO4/c1-4-15-9-6-12(8(3)11(13)14)7-10(9)16-5-2/h8-10H,4-7H2,1-3H3,(H,13,14)
InChIKeyWHBMCJVZUPIJAI-UHFFFAOYSA-N
MW231.29 g/mol
LogP0.59
Rot. Bonds6

About 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid

2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid (PubChem CID 121203953) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid.

Molecular Properties

Compound Name2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid
PubChem CID121203953
Molecular FormulaC11H21NO4
Molecular Weight231.29 g/mol
Exact Mass231.15
IUPAC Name2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid
SMILESCCOC1CN(C(C)C(=O)O)CC1OCC
InChIInChI=1S/C11H21NO4/c1-4-15-9-6-12(8(3)11(13)14)7-10(9)16-5-2/h8-10H,4-7H2,1-3H3,(H,13,14)
InChIKeyWHBMCJVZUPIJAI-UHFFFAOYSA-N
XLogP0.59
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.29
LogP ≤ 50.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid?
The IUPAC name of 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid (CID 121203953) is 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid.
What is the SMILES notation for 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid?
The canonical SMILES for 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid is CCOC1CN(C(C)C(=O)O)CC1OCC.
What is the InChIKey of 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid?
The InChIKey is WHBMCJVZUPIJAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4/c1-4-15-9-6-12(8(3)11(13)14)7-10(9)16-5-2/h8-10H,4-7H2,1-3H3,(H,13,14).
What are the key properties of 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid?
2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid has a molecular weight of 231.29 g/mol, XLogP of 0.59, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-diethoxypyrrolidin-1-yl)propanoic acid is sourced from PubChem (CID 121203953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).