(2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid

C12H23NO4 — CID 129499649

IUPAC(2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid
SMILESCCO[C@H]1CN([C@@H](CC)C(=O)O)C[C@H]1OCC
InChIInChI=1S/C12H23NO4/c1-4-9(12(14)15)13-7-10(16-5-2)11(8-13)17-6-3/h9-11H,4-8H2,1-3H3,(H,14,15)/t9-,10-,11+/m0/s1
InChIKeyKDWVZOSTSQKEDC-GARJFASQSA-N
MW245.32 g/mol
LogP0.98
Rot. Bonds7

About (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid

(2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid (PubChem CID 129499649) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid.

Molecular Properties

Compound Name(2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid
PubChem CID129499649
Molecular FormulaC12H23NO4
Molecular Weight245.32 g/mol
Exact Mass245.16
IUPAC Name(2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid
SMILESCCO[C@H]1CN([C@@H](CC)C(=O)O)C[C@H]1OCC
InChIInChI=1S/C12H23NO4/c1-4-9(12(14)15)13-7-10(16-5-2)11(8-13)17-6-3/h9-11H,4-8H2,1-3H3,(H,14,15)/t9-,10-,11+/m0/s1
InChIKeyKDWVZOSTSQKEDC-GARJFASQSA-N
XLogP0.98
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.32
LogP ≤ 50.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid?
The IUPAC name of (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid (CID 129499649) is (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid.
What is the SMILES notation for (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid?
The canonical SMILES for (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid is CCO[C@H]1CN([C@@H](CC)C(=O)O)C[C@H]1OCC.
What is the InChIKey of (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid?
The InChIKey is KDWVZOSTSQKEDC-GARJFASQSA-N. The full InChI is InChI=1S/C12H23NO4/c1-4-9(12(14)15)13-7-10(16-5-2)11(8-13)17-6-3/h9-11H,4-8H2,1-3H3,(H,14,15)/t9-,10-,11+/m0/s1.
What are the key properties of (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid?
(2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid has a molecular weight of 245.32 g/mol, XLogP of 0.98, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid is sourced from PubChem (CID 129499649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).