C12H23NO4 — CID 129499649
(2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid (PubChem CID 129499649) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 129499649 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (2S)-2-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]butanoic acid |
| SMILES | CCO[C@H]1CN([C@@H](CC)C(=O)O)C[C@H]1OCC |
| InChI | InChI=1S/C12H23NO4/c1-4-9(12(14)15)13-7-10(16-5-2)11(8-13)17-6-3/h9-11H,4-8H2,1-3H3,(H,14,15)/t9-,10-,11+/m0/s1 |
| InChIKey | KDWVZOSTSQKEDC-GARJFASQSA-N |
| XLogP | 0.98 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |