C9H13ClF3NO2 — CID 121203200
2-chloro-1-[3-(hydroxymethyl)-3-(trifluoromethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 121203200) has the molecular formula C9H13ClF3NO2 and a molecular weight of 259.65 g/mol. Its IUPAC name is 2-chloro-1-[3-(hydroxymethyl)-3-(trifluoromethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 2-chloro-1-[3-(hydroxymethyl)-3-(trifluoromethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 121203200 |
| Molecular Formula | C9H13ClF3NO2 |
| Molecular Weight | 259.65 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-chloro-1-[3-(hydroxymethyl)-3-(trifluoromethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CC(Cl)C(=O)N1CCC(CO)(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H13ClF3NO2/c1-6(10)7(16)14-3-2-8(4-14,5-15)9(11,12)13/h6,15H,2-5H2,1H3 |
| InChIKey | KKFCGPCAPJDXPF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.65 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|