C8H15F2N3O2 — CID 121204115
2-[4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 121204115) has the molecular formula C8H15F2N3O2 and a molecular weight of 223.22 g/mol. Its IUPAC name is 2-[4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 121204115 |
| Molecular Formula | C8H15F2N3O2 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-[4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | COCC1CC(F)(F)CN1C/C(N)=N/O |
| InChI | InChI=1S/C8H15F2N3O2/c1-15-4-6-2-8(9,10)5-13(6)3-7(11)12-14/h6,14H,2-5H2,1H3,(H2,11,12) |
| InChIKey | ZQFGZZQIWABGRN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|