C9H17F2N3O2 — CID 129497782
2-[(2S)-2-(ethoxymethyl)-4,4-difluoropyrrolidin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 129497782) has the molecular formula C9H17F2N3O2 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-[(2S)-2-(ethoxymethyl)-4,4-difluoropyrrolidin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[(2S)-2-(ethoxymethyl)-4,4-difluoropyrrolidin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 129497782 |
| Molecular Formula | C9H17F2N3O2 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-[(2S)-2-(ethoxymethyl)-4,4-difluoropyrrolidin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | CCOC[C@@H]1CC(F)(F)CN1CC(N)=NO |
| InChI | InChI=1S/C9H17F2N3O2/c1-2-16-5-7-3-9(10,11)6-14(7)4-8(12)13-15/h7,15H,2-6H2,1H3,(H2,12,13)/t7-/m0/s1 |
| InChIKey | HJBZWFPBIQIOHZ-ZETCQYMHSA-N |
| XLogP | 0.48 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|