C12H15ClN4 — CID 121205342
N-(4-chloroquinazolin-2-yl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 121205342) has the molecular formula C12H15ClN4 and a molecular weight of 250.73 g/mol. Its IUPAC name is N-(4-chloroquinazolin-2-yl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(4-chloroquinazolin-2-yl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 121205342 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N-(4-chloroquinazolin-2-yl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc(Cl)c2ccccc2n1 |
| InChI | InChI=1S/C12H15ClN4/c1-17(2)8-7-14-12-15-10-6-4-3-5-9(10)11(13)16-12/h3-6H,7-8H2,1-2H3,(H,14,15,16) |
| InChIKey | GTUFHDDRWDYAKU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |