C12H13N3O — CID 121205925
3-[[(1S)-1-phenylethyl]amino]-1H-pyridazin-6-one (PubChem CID 121205925) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 3-[[(1S)-1-phenylethyl]amino]-1H-pyridazin-6-one.
| Compound Name | 3-[[(1S)-1-phenylethyl]amino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 121205925 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-[[(1S)-1-phenylethyl]amino]-1H-pyridazin-6-one |
| SMILES | C[C@H](Nc1ccc(=O)[nH]n1)c1ccccc1 |
| InChI | InChI=1S/C12H13N3O/c1-9(10-5-3-2-4-6-10)13-11-7-8-12(16)15-14-11/h2-9H,1H3,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | AWYGPJLGISQBQR-VIFPVBQESA-N |
| XLogP | 1.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |