C11H12N2S — CID 57022691
N-(1-phenylethyl)-1,3-thiazol-4-amine (PubChem CID 57022691) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is N-(1-phenylethyl)-1,3-thiazol-4-amine.
| Compound Name | N-(1-phenylethyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 57022691 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | N-(1-phenylethyl)-1,3-thiazol-4-amine |
| SMILES | CC(Nc1cscn1)c1ccccc1 |
| InChI | InChI=1S/C11H12N2S/c1-9(10-5-3-2-4-6-10)13-11-7-14-8-12-11/h2-9,13H,1H3 |
| InChIKey | NKIDMPQNJXZTKL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |