C10H16N2O2 — CID 121207451
[1-(oxan-3-ylmethyl)pyrazol-4-yl]methanol (PubChem CID 121207451) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is [1-(oxan-3-ylmethyl)pyrazol-4-yl]methanol.
| Compound Name | [1-(oxan-3-ylmethyl)pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 121207451 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | [1-(oxan-3-ylmethyl)pyrazol-4-yl]methanol |
| SMILES | OCc1cnn(CC2CCCOC2)c1 |
| InChI | InChI=1S/C10H16N2O2/c13-7-10-4-11-12(6-10)5-9-2-1-3-14-8-9/h4,6,9,13H,1-3,5,7-8H2 |
| InChIKey | LYDPAXOXJIFXKH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |