C11H19N3O — CID 62731505
1-[1-(oxolan-3-ylmethyl)pyrazol-4-yl]propan-2-amine (PubChem CID 62731505) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-[1-(oxolan-3-ylmethyl)pyrazol-4-yl]propan-2-amine.
| Compound Name | 1-[1-(oxolan-3-ylmethyl)pyrazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 62731505 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-[1-(oxolan-3-ylmethyl)pyrazol-4-yl]propan-2-amine |
| SMILES | CC(N)Cc1cnn(CC2CCOC2)c1 |
| InChI | InChI=1S/C11H19N3O/c1-9(12)4-11-5-13-14(7-11)6-10-2-3-15-8-10/h5,7,9-10H,2-4,6,8,12H2,1H3 |
| InChIKey | MBDIXULAQJWCSG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |