C13H14N2O4S — CID 121210143
3-amino-6-tert-butylthieno[2,3-b]pyridine-2,4-dicarboxylic acid (PubChem CID 121210143) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-amino-6-tert-butylthieno[2,3-b]pyridine-2,4-dicarboxylic acid.
| Compound Name | 3-amino-6-tert-butylthieno[2,3-b]pyridine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 121210143 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-amino-6-tert-butylthieno[2,3-b]pyridine-2,4-dicarboxylic acid |
| SMILES | CC(C)(C)c1cc(C(=O)O)c2c(N)c(C(=O)O)sc2n1 |
| InChI | InChI=1S/C13H14N2O4S/c1-13(2,3)6-4-5(11(16)17)7-8(14)9(12(18)19)20-10(7)15-6/h4H,14H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | XZMJTRJETFGVKP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |