C10H9N3O — CID 121212601
5-ethyl-3-(furan-3-yl)-1H-pyrazole-4-carbonitrile (PubChem CID 121212601) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 5-ethyl-3-(furan-3-yl)-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-ethyl-3-(furan-3-yl)-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 121212601 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 5-ethyl-3-(furan-3-yl)-1H-pyrazole-4-carbonitrile |
| SMILES | CCc1[nH]nc(-c2ccoc2)c1C#N |
| InChI | InChI=1S/C10H9N3O/c1-2-9-8(5-11)10(13-12-9)7-3-4-14-6-7/h3-4,6H,2H2,1H3,(H,12,13) |
| InChIKey | XMWZSLJDVHBEFY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |