C10H16N2O — CID 121212716
(3-cyclopentyl-5-methyl-1H-pyrazol-4-yl)methanol (PubChem CID 121212716) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (3-cyclopentyl-5-methyl-1H-pyrazol-4-yl)methanol.
| Compound Name | (3-cyclopentyl-5-methyl-1H-pyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 121212716 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (3-cyclopentyl-5-methyl-1H-pyrazol-4-yl)methanol |
| SMILES | Cc1[nH]nc(C2CCCC2)c1CO |
| InChI | InChI=1S/C10H16N2O/c1-7-9(6-13)10(12-11-7)8-4-2-3-5-8/h8,13H,2-6H2,1H3,(H,11,12) |
| InChIKey | LZTFDHSQJFMOPZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |