C10H11FN2OS — CID 121213356
[1-(2-fluoroethyl)-3-thiophen-2-ylpyrazol-4-yl]methanol (PubChem CID 121213356) has the molecular formula C10H11FN2OS and a molecular weight of 226.28 g/mol. Its IUPAC name is [1-(2-fluoroethyl)-3-thiophen-2-ylpyrazol-4-yl]methanol.
| Compound Name | [1-(2-fluoroethyl)-3-thiophen-2-ylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 121213356 |
| Molecular Formula | C10H11FN2OS |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | [1-(2-fluoroethyl)-3-thiophen-2-ylpyrazol-4-yl]methanol |
| SMILES | OCc1cn(CCF)nc1-c1cccs1 |
| InChI | InChI=1S/C10H11FN2OS/c11-3-4-13-6-8(7-14)10(12-13)9-2-1-5-15-9/h1-2,5-6,14H,3-4,7H2 |
| InChIKey | BSIKSACIADGRLB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |