C12H14FN3O — CID 121213868
2-[1-(2-fluoroethyl)-3-pyridin-3-ylpyrazol-4-yl]ethanol (PubChem CID 121213868) has the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. Its IUPAC name is 2-[1-(2-fluoroethyl)-3-pyridin-3-ylpyrazol-4-yl]ethanol.
| Compound Name | 2-[1-(2-fluoroethyl)-3-pyridin-3-ylpyrazol-4-yl]ethanol |
|---|---|
| PubChem CID | 121213868 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-[1-(2-fluoroethyl)-3-pyridin-3-ylpyrazol-4-yl]ethanol |
| SMILES | OCCc1cn(CCF)nc1-c1cccnc1 |
| InChI | InChI=1S/C12H14FN3O/c13-4-6-16-9-11(3-7-17)12(15-16)10-2-1-5-14-8-10/h1-2,5,8-9,17H,3-4,6-7H2 |
| InChIKey | URVOTFTXPWELSI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |