About (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine
(1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine (PubChem CID 121215196) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine.
Analyze (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine?
The IUPAC name of (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine (CID 121215196) is (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine.
What is the SMILES notation for (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine?
The canonical SMILES for (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine is Cc1nn2ccn(C)c2c1CN.
What is the InChIKey of (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine?
The InChIKey is MCAMEFSOUCMEBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-6-7(5-9)8-11(2)3-4-12(8)10-6/h3-4H,5,9H2,1-2H3.
What are the key properties of (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine?
(1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine has a molecular weight of 164.21 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6-dimethylimidazo[2,1-e]pyrazol-7-yl)methanamine is sourced from PubChem (CID 121215196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).